| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:26 UTC |
|---|
| Update Date | 2025-03-25 00:56:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220860 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O7 |
|---|
| Molecular Mass | 292.0583 |
|---|
| SMILES | O=C1CCC(C(=O)COC(=O)c2ccccc2C(=O)O)O1 |
|---|
| InChI Key | NTBVNJWAWSJEBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalpha-acyloxy ketonesbenzoic acidsbenzoyl derivativescarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesketonesorganic oxidesoxacyclic compoundstetrahydrofuranstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-acyloxy ketonearomatic heteromonocyclic compoundbenzoyltricarboxylic acid or derivativesbenzoate estercarboxylic acid derivativeketonelactoneorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidorganoheterocyclic compoundtetrahydrofurangamma butyrolactoneoxacycleorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganooxygen compound |
|---|