| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:26 UTC |
|---|
| Update Date | 2025-03-25 00:56:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220882 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O4 |
|---|
| Molecular Mass | 244.0736 |
|---|
| SMILES | O=C1CC(O)Cc2oc(-c3ccc(O)cc3)cc21 |
|---|
| InChI Key | QGURBFLAGFBTOI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | benzofurans |
|---|
| Direct Parent | benzofurans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonesbenzene and substituted derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholfuranmonocyclic benzene moietyfuroic acid or derivativesaryl alkyl ketonebenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|