| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:29 UTC |
|---|
| Update Date | 2025-03-25 00:56:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220986 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O3 |
|---|
| Molecular Mass | 254.0943 |
|---|
| SMILES | O=C(O)c1cccc2c1OCC(c1ccccc1)C2 |
|---|
| InChI Key | UPJJGVSKTZLZAO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-carboxy-2-haloaromatic compoundsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | isoflavanmonocyclic benzene moietyetherbenzopyrancarboxylic acid1-benzopyranalkyl aryl ethercarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundchromanehydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundorganoheterocyclic compoundorganooxygen compound |
|---|