| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:30 UTC |
|---|
| Update Date | 2025-03-25 00:56:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221020 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H21NO3 |
|---|
| Molecular Mass | 347.1521 |
|---|
| SMILES | O=C(O)c1ccc(NCCOC(c2ccccc2)c2ccccc2)cc1 |
|---|
| InChI Key | OUPCBWRFWUFRFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsbenzoic acidsbenzoyl derivativesbenzyletherscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminessecondary alkylarylamines |
|---|
| Substituents | diphenylmethaneethercarboxylic acidbenzyletheramino acid or derivativesamino acidbenzoylcarboxylic acid derivativedialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acidbenzoic acid or derivativessecondary aminesecondary aliphatic/aromatic aminearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
