| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:30 UTC |
|---|
| Update Date | 2025-03-25 00:56:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221037 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7FO6 |
|---|
| Molecular Mass | 230.0227 |
|---|
| SMILES | O=C(O)c1ccc(C(O)(F)C(=O)O)cc1O |
|---|
| InChI Key | XUZWZWXIXYYFBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl fluoridesalpha hydroxy acids and derivativesalpha-halocarboxylic acidsaromatic alcoholsbenzoic acidsbenzoyl derivativescarbonyl compoundsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesvinylogous acids |
|---|
| Substituents | aromatic alcoholalpha-halocarboxylic acid or derivativescarbonyl groupcarboxylic acidalpha-hydroxy acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidalpha-halocarboxylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxidealkyl halide1-carboxy-2-haloaromatic compoundbenzoic acidalcoholalkyl fluorideorganofluoridehydroxy acid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compounddicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|
