| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:31 UTC |
|---|
| Update Date | 2025-03-25 00:56:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221045 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H3F3O5S |
|---|
| Molecular Mass | 243.9653 |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)C(F)(F)F)o1 |
|---|
| InChI Key | WBXAKKHTINMUOG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundsoxacyclic compoundssulfonestrihalomethanes |
|---|
| Substituents | halomethanetrihalomethanecarboxylic acidaromatic heteromonocyclic compoundalkyl fluorideorganofluorideheteroaromatic compoundorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundfuroic acidoxacycleorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compoundsulfone |
|---|