| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 15:08:31 UTC |
|---|
| Update Date | 2025-03-25 00:56:50 UTC |
|---|
| HMDB ID | HMDB0137517 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221060 |
|---|
| Name | 2-[(2,4-dihydroxyphenyl)methylidene]-6-hydroxy-2,3-dihydro-1-benzofuran-3-one |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O5 |
|---|
| Molecular Mass | 270.0528 |
|---|
| SMILES | O=C1C(=Cc2ccc(O)cc2O)Oc2cc(O)ccc21 |
|---|
| InChI Key | MKRZQRDYRUVFAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | aurone flavonoids |
|---|
| Subclass | aurone flavonoids |
|---|
| Direct Parent | aurone flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesbenzene and substituted derivativesbenzofuranonescoumaranshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsresorcinols |
|---|
| Substituents | monocyclic benzene moietyauronebenzofuranonebenzofuran1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidresorcinolketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundcoumaranorganooxygen compoundaryl ketone |
|---|
