| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:33 UTC |
|---|
| Update Date | 2025-03-25 00:56:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221132 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14O12P2 |
|---|
| Molecular Mass | 339.996 |
|---|
| SMILES | O=C(OP(=O)(O)OCC(O)COP(=O)(O)O)C(O)CO |
|---|
| InChI Key | ILWHFUCIHKYETD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphates |
|---|
| Direct Parent | glycerophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl phosphatesbeta hydroxy acids and derivativescarbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundsn-glycerol-3-phosphatecarbonyl groupmonosaccharidehydroxy acidcarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterglyceric_acidmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundacyl phosphate |
|---|