| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:37 UTC |
|---|
| Update Date | 2025-03-25 00:56:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221288 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O9 |
|---|
| Molecular Mass | 352.0794 |
|---|
| SMILES | O=C(O)CC(=O)CCC(OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
|---|
| InChI Key | IYCIGZVBHVSUSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsenoate estersfatty acid estershydrocarbon derivativesorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylbeta-hydroxy ketonemonocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativescarboxylic acid derivativebeta-keto acidketonealpha,beta-unsaturated carboxylic esterorganic oxideenoate ester1-hydroxy-4-unsubstituted benzenoidhydroxycinnamic acidaromatic homomonocyclic compoundfatty acid esterorganic oxygen compoundketo acidcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
