| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:38 UTC |
|---|
| Update Date | 2025-03-25 00:56:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221332 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H17NO7 |
|---|
| Molecular Mass | 359.1005 |
|---|
| SMILES | O=C(O)C1OC(O)C(O)C(O)C1Oc1ccc2c(c1)[nH]c1ccccc12 |
|---|
| InChI Key | WKDPXWFSTMQCCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | carbazoles |
|---|
| Direct Parent | carbazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersazacyclic compoundscarbonyl compoundscarboxylic acidsglucuronic acid derivativeshemiacetalsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyrrolessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidglucuronic acid or derivativesindolemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidsaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxane1,2-diolalcoholpyran carboxylic acid or derivativesazacycleheteroaromatic compoundcarbazoleoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyranpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
