| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:40 UTC |
|---|
| Update Date | 2025-03-25 00:56:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221401 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16Cl2O11S |
|---|
| Molecular Mass | 509.979 |
|---|
| SMILES | O=C(O)C1OC(Oc2cc(Cl)ccc2Oc2ccc(S(=O)(=O)O)cc2Cl)C(O)C(O)C1O |
|---|
| InChI Key | ARAACBLLCOZTFP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsacetalsaryl chloridesarylsulfonic acids and derivativesbenzenesulfonic acids and derivativesbenzenesulfonyl compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidschlorobenzenesdiarylethersdiphenylethersglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesorganosulfonic acidsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholssulfonyls |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietyorganosulfonic acid or derivativescarbonyl groupcarboxylic acidetheraromatic heteromonocyclic compoundorganochlorideorganosulfonic acido-glucuronidemonosaccharidebenzenesulfonateorganosulfur compoundcarboxylic acid derivativepyran carboxylic acidorganohalogen compound1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzenealcoholpyran carboxylic acid or derivatives1-sulfo,2-unsubstituted aromatic compoundhydroxy acidaryl halideoxacyclemonocarboxylic acid or derivativessulfonylarylsulfonic acid or derivativesorganic sulfonic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidhalobenzenephenoxy compounddiphenylether |
|---|