| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:40 UTC |
|---|
| Update Date | 2025-03-25 00:56:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221425 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H26O14 |
|---|
| Molecular Mass | 430.1323 |
|---|
| SMILES | O=C(O)C1OC(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1OCC(O)CO |
|---|
| InChI Key | JHPPPPWWQHZHDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidsdialkyl ethersglucuronic acid derivativesglycerol ethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupethercarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl ether1-o-glucuronideorganic oxideacetalaliphatic heteromonocyclic compoundoxaneprimary alcoholglycerol etherorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesoxacyclemonocarboxylic acid or derivativespyranglycerolipidsecondary alcoholhydrocarbon derivative |
|---|