| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:42 UTC |
|---|
| Update Date | 2025-03-25 00:56:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221488 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O5 |
|---|
| Molecular Mass | 230.0903 |
|---|
| SMILES | O=C(O)CCC1(O)COCC2NC(=O)NC21 |
|---|
| InChI Key | GVRNHJPXNLINBI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanestertiary alcohols |
|---|
| Substituents | imidazolidinecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativedialkyl etheraliphatic heteropolycyclic compoundimidazolidinoneorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycleoxacycletertiary alcoholmonocarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compound |
|---|
