| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 15:08:42 UTC |
|---|
| Update Date | 2025-03-25 00:56:55 UTC |
|---|
| HMDB ID | HMDB0037831 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221502 |
|---|
| Name | xi-8-Hydroxyhexadecanedioic acid |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H30O5 |
|---|
| Molecular Mass | 302.2093 |
|---|
| SMILES | O=C(O)CCCCCCCC(O)CCCCCCC(=O)O |
|---|
| InChI Key | GZQVGXLMHGPBET-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl grouplong-chain fatty acidcarboxylic acidcarboxylic acid derivativeorganic oxideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidorganooxygen compound |
|---|