| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:44 UTC |
|---|
| Update Date | 2025-03-25 00:56:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221580 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8Cl2O5 |
|---|
| Molecular Mass | 277.9749 |
|---|
| SMILES | O=C(O)CC(Oc1ccc(Cl)c(Cl)c1)C(=O)O |
|---|
| InChI Key | VFVFVQBXUNQPPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesdichlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | aryl chloridechlorobenzenephenol etherphenoxyacetatecarbonyl groupethercarboxylic acidorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivative1,2-dichlorobenzenehalobenzenephenoxy compoundorganooxygen compound |
|---|
