| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:48 UTC |
|---|
| Update Date | 2025-03-25 00:56:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221699 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14O6 |
|---|
| Molecular Mass | 326.079 |
|---|
| SMILES | O=C(O)CC1Cc2cc3c(cc2-c2cc4c(cc21)OCO4)OCO3 |
|---|
| InChI Key | QBXUTOLKXKPSCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsbenzodioxolescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesoxacyclic compounds |
|---|
| Substituents | phenanthrenecarbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|
