| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:52 UTC |
|---|
| Update Date | 2025-03-25 00:56:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221867 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14O7 |
|---|
| Molecular Mass | 294.074 |
|---|
| SMILES | O=c1cc(C2OC(CO)C(O)C2O)c2ccc(O)cc2o1 |
|---|
| InChI Key | GUFVYAVJHNFFFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | hydroxycoumarins |
|---|
| Direct Parent | 7-hydroxycoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsbenzenoidscoumarins and derivativesdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholspyranones and derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | ether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidedialkyl etherlactonesaccharideorganic oxidearomatic heteropolycyclic compoundpyranoneprimary alcoholorganoheterocyclic compoundalcoholbenzopyran7-hydroxycoumarintetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
