| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:53 UTC |
|---|
| Update Date | 2025-03-25 00:56:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221899 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H12O7 |
|---|
| Molecular Mass | 364.0583 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)cc(O)cc2oc3ccc(O)c(O)c3c(=O)c12 |
|---|
| InChI Key | GYMIESCILMHNCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | cycloheptapyrans |
|---|
| Subclass | cycloheptapyrans |
|---|
| Direct Parent | cycloheptapyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeschromonesheteroaromatic compoundsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativestroponesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietytroponebenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcycloheptapyranoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
