| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:54 UTC |
|---|
| Update Date | 2025-03-25 00:56:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221945 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O10P2 |
|---|
| Molecular Mass | 355.9811 |
|---|
| SMILES | O=c1ccn(C2OC(P(=O)(O)O)C3OP(=O)(O)OC32)c(=O)[nH]1 |
|---|
| InChI Key | ZETGJYLZJITRNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganic phosphoric acids and derivativesorganonitrogen compoundsorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonestetrahydrofuransvinylogous amides |
|---|
| Substituents | ribonucleoside 3'-phosphatevinylogous amidecarbonic acid derivativelactamazacycletetrahydrofuranheteroaromatic compoundpyrimidone1,3_dioxaphospholanepyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganophosphonic acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
