| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:55 UTC |
|---|
| Update Date | 2025-03-25 00:56:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221997 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13ClO4 |
|---|
| Molecular Mass | 292.0502 |
|---|
| SMILES | Oc1ccc(C2CCc3cc(Cl)c(O)cc3O2)cc1O |
|---|
| InChI Key | CGULIKRSPFLKIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3'-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersaryl chloridesbenzene and substituted derivativesflavanshydrocarbon derivativesorganochloridesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyether1-benzopyranflavanorganochloride1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganohalogen compoundaromatic heteropolycyclic compoundchromaneorganoheterocyclic compoundaryl chloridebenzopyran1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidaryl halideoxacycleorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|