| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:55 UTC |
|---|
| Update Date | 2025-03-25 00:56:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02221998 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H22O11 |
|---|
| Molecular Mass | 438.1162 |
|---|
| SMILES | Oc1ccc(C2COc3cc(OC4C(O)C(O)C(O)C(O)C4O)cc(O)c3O2)cc1O |
|---|
| InChI Key | VFJWHSVPJTXPJU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxanes |
|---|
| Subclass | phenylbenzodioxanes |
|---|
| Direct Parent | phenylbenzo-1,4-dioxanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesbenzo-1,4-dioxanescyclitols and derivativescyclohexanolshydrocarbon derivativesoxacyclic compoundspara dioxinsphenol ethers |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundalcohol2-phenylbenzo-1,4-dioxanebenzo-1,4-dioxanecyclohexanolcyclitol or derivatives1-hydroxy-4-unsubstituted benzenoidcyclic alcoholoxacycleorganic oxygen compoundpara-dioxinsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|