| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:56 UTC |
|---|
| Update Date | 2025-03-25 00:57:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222030 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11N3O2 |
|---|
| Molecular Mass | 253.0851 |
|---|
| SMILES | Oc1ccc(Nc2ncnc3cc(O)ccc23)cc1 |
|---|
| InChI Key | BHYIXXPMKKFRJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazanaphthalenes |
|---|
| Subclass | benzodiazines |
|---|
| Direct Parent | quinazolinamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganooxygen compoundsorganopnictogen compoundspyrimidines and pyrimidine derivativessecondary amines |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidsecondary aminepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundquinazolinamineorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundimidolactamorganooxygen compoundamine |
|---|
