| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:58 UTC |
|---|
| Update Date | 2025-03-25 00:57:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222095 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2 |
|---|
| Molecular Mass | 224.1313 |
|---|
| SMILES | c1cncc(-c2ccc(C3CCCN3)cc2)c1 |
|---|
| InChI Key | SGGWRNHSPXFUKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | phenylpyrrolidines |
|---|
| Direct Parent | phenylpyrrolidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspyridines and derivativespyrroles |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietyaromatic heteromonocyclic compoundazacycle2-phenylpyrrolidineheteroaromatic compoundsecondary aminepyridinepyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamine |
|---|
