| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:02 UTC |
|---|
| Update Date | 2025-03-25 00:57:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222266 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N2O |
|---|
| Molecular Mass | 244.1576 |
|---|
| SMILES | OCCN1CCC(c2cc3ccccc3[nH]2)CC1 |
|---|
| InChI Key | AMPRHTMZNGTGAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalcohols and polyolsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspiperidinespyrrolestrialkylamines |
|---|
| Substituents | alcoholazacycle1,2-aminoalcoholindoleheteroaromatic compoundtertiary aliphatic amineorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundpiperidineaminetertiary amineorganooxygen compoundalkanolamine |
|---|