| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:03 UTC |
|---|
| Update Date | 2025-03-25 00:57:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222277 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9ClO2 |
|---|
| Molecular Mass | 220.0291 |
|---|
| SMILES | Oc1cc(O)c(-c2ccccc2)cc1Cl |
|---|
| InChI Key | VWSWELJZGSVFKL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | biphenyls and derivatives |
|---|
| Direct Parent | chlorinated biphenyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl chlorideschlorobenzeneshalophenolshydrocarbon derivativeso-chlorophenolsorganochloridesorganooxygen compoundsp-chlorophenolsresorcinols |
|---|
| Substituents | aryl chloride2-chlorophenolchlorobenzene4-chlorophenolorganochloride1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundresorcinolaryl halidearomatic homomonocyclic compound2-halophenol4-halophenolorganic oxygen compoundphenolhydrocarbon derivativehalobenzenechlorinated biphenylorganooxygen compound |
|---|