| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:03 UTC |
|---|
| Update Date | 2025-03-25 00:57:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222284 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO7 |
|---|
| Molecular Mass | 339.1318 |
|---|
| SMILES | OCCc1cn(C2OC(CO)C(O)C(O)C2O)c2ccc(O)cc12 |
|---|
| InChI Key | PPPXEHZYAYAUGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | 1-pyranosylindoles |
|---|
| Direct Parent | 1-pyranosylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesn-alkylindolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssubstituted pyrroles |
|---|
| Substituents | n-alkylindoleindole1-hydroxy-2-unsubstituted benzenoidmonosaccharidesubstituted pyrrole1-pyranosylindolesaccharidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundindole or derivativesoxacycleorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
