| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:06 UTC |
|---|
| Update Date | 2025-03-25 00:57:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222393 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H7O9PS |
|---|
| Molecular Mass | 249.9548 |
|---|
| SMILES | O=CC(O)COP(=O)(O)OS(=O)(=O)O |
|---|
| InChI Key | IVQCFAUMARKPJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glyceraldehyde-3-phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydeshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic sulfuric acids and derivativessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl grouporganic sulfuric acid or derivativesaldehydeorganic oxidealpha-hydroxyaldehydeglyceraldehyde-3-phosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|