| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:06 UTC |
|---|
| Update Date | 2025-03-25 00:57:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222413 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9NO3 |
|---|
| Molecular Mass | 203.0582 |
|---|
| SMILES | O=CCc1cccc2[nH]c(C(=O)O)cc12 |
|---|
| InChI Key | CWQNYGGNACSVLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydrogen aldehydesazacyclic compoundsbenzenoidscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetaldehydespyrrole 2-carboxylic acidspyrrole carboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidindolecarboxylic acid derivativeorganic oxidepyrrole-2-carboxylic acidpyrrole-2-carboxylic acid or derivativesaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundindolecarboxylic acid derivativeazacycleheteroaromatic compoundaldehydemonocarboxylic acid or derivativesorganic oxygen compoundalpha-hydrogen aldehydepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundphenylacetaldehyde |
|---|
