| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:07 UTC |
|---|
| Update Date | 2025-03-25 00:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222436 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H47N3O17S |
|---|
| Molecular Mass | 729.2626 |
|---|
| SMILES | O=CC(O)C(O)C(OC1OC(CO)C(O)C(OC2OC(CO)C(O)C(O)C2NC(=O)CCCCC2SCC3NC(=O)NC32)C1O)C(O)CO |
|---|
| InChI Key | CBFKSPPCAOSIAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | biotin and derivatives |
|---|
| Subclass | biotin and derivatives |
|---|
| Direct Parent | biotin and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsacylaminosugarsalkyl glycosidesalpha-hydroxyaldehydesazacyclic compoundsbeta-hydroxy aldehydescarboxylic acids and derivativesdialkylthioethersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesimidazolidinonesmonosaccharidesn-acyl aminesn-acyl-alpha-hexosaminesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidesthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupfatty amidemonosaccharidethiophenecarboxylic acid derivativen-acyl-alpha-hexosaminealiphatic heteropolycyclic compoundimidazolidinonesaccharideorganic oxidealpha-hydroxyaldehydeacetalbiotin_derivativeorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholalcoholamino saccharidecarbonic acid derivativefatty acyl glycosideazacycledialkylthioetheraldehydethienoimidazolidinecarboxamide groupn-acyl-amineacylaminosugaroxacyclesecondary carboxylic acid amideorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|