| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:08 UTC |
|---|
| Update Date | 2025-03-25 00:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222484 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O5S |
|---|
| Molecular Mass | 246.031 |
|---|
| SMILES | O=C1NC2CSC(C(O)C(=O)C(=O)O)C2N1 |
|---|
| InChI Key | UQVIHBOCOXKWKC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesalpha-keto acids and derivativesazacyclic compoundsbeta hydroxy acids and derivativescarboxylic acidsdialkylthioethersfatty acylshydrocarbon derivativeshydroxy fatty acidsimidazolidinonesmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholsthia fatty acidsthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylcarbonyl groupcarboxylic acidmonosaccharidethiophenealpha-hydroxy ketonecarboxylic acid derivativeketonealiphatic heteropolycyclic compoundimidazolidinonebeta-hydroxy acidsaccharideorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundhydroxy fatty acidalcoholcarbonic acid derivativeazacycledialkylthioetherhydroxy acidthienoimidazolidinemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioetherketo acidacyloinsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
