| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:08 UTC |
|---|
| Update Date | 2025-03-25 00:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222490 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13N3O2S |
|---|
| Molecular Mass | 275.0728 |
|---|
| SMILES | O=C1NC2CSC(c3c[nH]c4ccc(O)cc34)C2N1 |
|---|
| InChI Key | YPSFBVXHFBHODA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidscarbonyl compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolesthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinecarbonyl groupindole1-hydroxy-2-unsubstituted benzenoidthiopheneimidazolidinoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundcarbonic acid derivativeazacycledialkylthioetherheteroaromatic compoundthienoimidazolidineorganic oxygen compoundthioetherpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
