| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:09 UTC |
|---|
| Update Date | 2025-03-25 00:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222511 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8N2O3S |
|---|
| Molecular Mass | 224.0256 |
|---|
| SMILES | O=C1NC(=Cc2ccccc2)S(=O)(=O)N1 |
|---|
| InChI Key | QGXZVUZTQFAVJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | sulfonylureas |
|---|
| Direct Parent | sulfonylureas |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesthiadiazolidines |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundthiadiazolidineazacycleorganic oxideorganic oxygen compoundorganic sulfonic acid or derivativessulfonylureaorganopnictogen compoundhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
