| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:09 UTC |
|---|
| Update Date | 2025-03-25 00:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222522 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO2 |
|---|
| Molecular Mass | 251.0946 |
|---|
| SMILES | O=C1NC(=O)C(c2ccccc2)C1c1ccccc1 |
|---|
| InChI Key | DETGQEZQCWQUHU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylpyrrolidinespyrrolespyrrolidine-2-ones |
|---|
| Substituents | 2-pyrrolidonemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundazacyclecarboxylic acid derivativecarboxylic acid imide3-phenylpyrrolidinecarboxylic acid imide, n-unsubstitutedorganic oxideorganic oxygen compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundorganooxygen compoundstilbene |
|---|