| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:09 UTC |
|---|
| Update Date | 2025-03-25 00:57:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222545 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H8O4 |
|---|
| Molecular Mass | 252.0423 |
|---|
| SMILES | O=C1Oc2c(O)ccc3c2ccc2ccc(O)c1c23 |
|---|
| InChI Key | KYSZFRNPZPTXRC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsvinylogous acids |
|---|
| Substituents | phenanthrol1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacyclevinylogous acidorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterhydrocarbon derivative2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|