| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:10 UTC |
|---|
| Update Date | 2025-03-25 00:57:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222578 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H25N3O2 |
|---|
| Molecular Mass | 351.1947 |
|---|
| SMILES | O=C1Nc2ccccc2C12CCN(CCCC(O)c1cccnc1)CC2 |
|---|
| InChI Key | BZNQZAAKHOFXGO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesindolineslactamsorganic oxidesorganopnictogen compoundspiperidinessecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aromatic alcoholcarbonyl grouplactamamino acid or derivativesindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddihydroindolepiperidinetertiary aminealcoholazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridinecarboxamide groupsecondary carboxylic acid amidepyridineorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
