| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:11 UTC |
|---|
| Update Date | 2025-03-25 00:57:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222593 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14O8 |
|---|
| Molecular Mass | 358.0689 |
|---|
| SMILES | O=C1OC(Oc2ccc3c(c2)oc(=O)c2ccccc23)C(O)C(O)C1O |
|---|
| InChI Key | YKKGLCGXAKFHML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans2-benzopyransacetalscarbonyl compoundscarboxylic acid estersdelta valerolactonesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyranones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl group1-benzopyrandelta valerolactonemonosaccharidecarboxylic acid derivativelactonesaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxanedelta_valerolactoneorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compoundisocoumarincoumarinoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyrancarboxylic acid ester2-benzopyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
