| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:12 UTC |
|---|
| Update Date | 2025-03-25 00:57:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222626 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6ClNO3S |
|---|
| Molecular Mass | 242.9757 |
|---|
| SMILES | O=S(=O)(O)c1ccnc2cc(Cl)ccc12 |
|---|
| InChI Key | GXNFOSWSBAOMOU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | haloquinolines |
|---|
| Direct Parent | haloquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compounds2-halopyridinesaryl chloridesarylsulfonic acids and derivativesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidspolyhalopyridinessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativespolyhalopyridineorganochlorideorganosulfonic acidorganosulfur compoundorganohalogen compoundhaloquinolineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridinearyl chloride1-sulfo,2-unsubstituted aromatic compoundazacycleheteroaromatic compoundhydroxypyridinearyl halidesulfonylpyridinearylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|