| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:13 UTC |
|---|
| Update Date | 2025-03-25 00:57:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222670 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O9S |
|---|
| Molecular Mass | 322.0359 |
|---|
| SMILES | O=S(=O)(O)Oc1cc(C2CC(O)C(O)C(O)O2)ccc1O |
|---|
| InChI Key | OBSYWGJSPBENIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoidshemiacetalshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholmonocyclic benzene moietysulfuric acid monoesteraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidphenylsulfateoxacycleorganic oxideorganic oxygen compoundsecondary alcoholsulfate-esterphenolhemiacetalhydrocarbon derivativebenzenoidphenoxy compoundoxanesulfuric acid esterorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|