| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222769 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15O12PS |
|---|
| Molecular Mass | 354.0022 |
|---|
| SMILES | O=P(O)(O)OCC1C(O)C(O)C(O)C(O)C1OS(=O)(=O)O |
|---|
| InChI Key | BPPDJRADPNNWFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescyclitols and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholorganic oxidephosphoric acid estermonoalkyl phosphatealkyl sulfatealiphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativesulfuric acid esterorganic phosphoric acid derivativealkyl phosphate |
|---|
