| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:17 UTC |
|---|
| Update Date | 2025-03-25 00:57:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222848 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7N3O5S2 |
|---|
| Molecular Mass | 276.9827 |
|---|
| SMILES | O=S(=O)(O)NC1=NS(=O)(=O)c2ccccc2N1 |
|---|
| InChI Key | CIXNOBYTTHPHMX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thiadiazines |
|---|
| Subclass | benzothiadiazines |
|---|
| Direct Parent | 1,2,4-benzothiadiazine-1,1-dioxides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsguanidineshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundsorganosulfonic acids and derivatives |
|---|
| Substituents | organosulfonic acid or derivativesorganic sulfuric acid or derivativesazacycleguanidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compound1,2,4-benzothiadiazine-1,1-dioxidehydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
