| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:17 UTC |
|---|
| Update Date | 2025-03-25 00:57:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222853 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13NO3S |
|---|
| Molecular Mass | 275.0616 |
|---|
| SMILES | O=S(=O)(O)N1c2ccccc2CC1c1ccccc1 |
|---|
| InChI Key | MKNPBTYZXFADKC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoamides |
|---|
| Substituents | monocyclic benzene moietyorganic sulfuric acid or derivativesazacycleindoleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|