| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:19 UTC |
|---|
| Update Date | 2025-03-25 00:57:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02222912 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | CH8O14P4 |
|---|
| Molecular Mass | 367.8865 |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)C(O)(O)P(=O)(O)O |
|---|
| InChI Key | AUZYOSBLZMZZPS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundbisphosphonateorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganooxygen compound |
|---|