| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:27 UTC |
|---|
| Update Date | 2025-03-25 00:57:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223222 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15NO7 |
|---|
| Molecular Mass | 249.0849 |
|---|
| SMILES | NC1CC(O)C(O)(C(=O)O)CC1C(O)C(=O)O |
|---|
| InChI Key | KECIYQXYSIQUHG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativescyclohexanolsdicarboxylic acids and derivativesgamma amino acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidgamma amino acid or derivativesalpha-hydroxy acidcyclohexanolhydroxy acidcyclic alcoholbeta-hydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativesorganopnictogen compounddelta amino acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
