| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:30 UTC |
|---|
| Update Date | 2025-03-25 00:57:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223321 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H25N3O3 |
|---|
| Molecular Mass | 355.1896 |
|---|
| SMILES | NC(Cc1ccc(O)cc1)C(=O)N1CCN(Cc2ccc(O)cc2)CC1 |
|---|
| InChI Key | YKJXOZZYBSDSQP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamphetamines and derivativesaralkylaminesazacyclic compoundsbenzylaminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesn-alkylpiperazinesorganic oxidesorganopnictogen compoundsphenylmethylaminestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidaralkylamineorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundamphetamine or derivativesalpha-amino acid amideazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide groupphenylmethylamineorganic oxygen compoundbenzylamine1,4-diazinanephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
