| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:37 UTC |
|---|
| Update Date | 2025-03-25 00:57:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223619 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21N5O |
|---|
| Molecular Mass | 299.1746 |
|---|
| SMILES | N=C(N)NCCCC(N)C(=O)Nc1cccc2ccccc12 |
|---|
| InChI Key | YVAGBWHAIGAPOM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidscarbonyl compoundscarboximidamidescarboxylic acids and derivativesfatty amidesguanidineshydrocarbon derivativesiminesmonoalkylaminesn-arylamidesnaphthalenesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupguanidineiminefatty amiden-arylamideorganic oxidearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundalpha-amino acid amidearomatic homopolycyclic compoundcarboximidamidecarboxamide groupsecondary carboxylic acid amidenaphthaleneorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
