| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:39 UTC |
|---|
| Update Date | 2025-03-25 00:57:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223689 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N3O6S |
|---|
| Molecular Mass | 275.0212 |
|---|
| SMILES | N=C(NC(=O)OS(=O)(=O)O)Nc1ccc(O)cc1 |
|---|
| InChI Key | ZGGJIEFYQFUBED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboximidamidesguanidineshydrocarbon derivativesiminesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativesguanidineimine1-hydroxy-2-unsubstituted benzenoidcarboximidamidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
