| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:41 UTC |
|---|
| Update Date | 2025-03-25 00:57:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223758 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22N4O4 |
|---|
| Molecular Mass | 334.1641 |
|---|
| SMILES | NC(=O)c1ccc(N2CCN(C(=O)CCC(N)C(=O)O)CC2)cc1 |
|---|
| InChI Key | JTZBVSVPVUMLPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylamineshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinesprimary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietycarbonyl groupcarboxylic acidglutamine or derivativesaromatic heteromonocyclic compoundamino acidbenzoylbenzamideorganic oxidepiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary amineorganoheterocyclic compoundazacycleaniline or substituted anilinesbenzoic acid or derivativescarboxamide groupaminobenzamidephenylpiperazinemonocarboxylic acid or derivativesorganic oxygen compound1,4-diazinanehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|