| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:41 UTC |
|---|
| Update Date | 2025-03-25 00:57:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223759 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N7O |
|---|
| Molecular Mass | 299.1495 |
|---|
| SMILES | NC(=O)c1ccc(NCC2CNc3ncnc(N)c3N2)cc1 |
|---|
| InChI Key | VXAHDRHDBLZMGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylalkylaminesprimary aminesprimary carboxylic acid amidespyrimidines and pyrimidine derivativessecondary alkylarylamines |
|---|
| Substituents | primary carboxylic acid amideamino acid or derivativesbenzoylcarboxylic acid derivativebenzamidepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazacycleheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic amineorganic oxygen compoundphenylalkylaminehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
