| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:42 UTC |
|---|
| Update Date | 2025-03-25 00:57:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223780 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO4 |
|---|
| Molecular Mass | 249.1001 |
|---|
| SMILES | NC(=O)c1cccc(C2CCC(CC(=O)O)O2)c1 |
|---|
| InChI Key | UZOYTXPFLDTECE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundbenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundtetrahydrofurancarboxamide groupoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
