| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:45 UTC |
|---|
| Update Date | 2025-03-25 00:57:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223920 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9N3O4S |
|---|
| Molecular Mass | 231.0314 |
|---|
| SMILES | NC(=O)Nc1ccc(O)c(S(N)(=O)=O)c1 |
|---|
| InChI Key | RGOJCOGXLKHLCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundshydrocarbon derivativesn-phenylureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarbonic acid derivativebenzenesulfonamideaminosulfonyl compound1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundorganosulfonic acid amidearomatic homomonocyclic compoundn-phenylureaorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundbenzenesulfonyl group |
|---|
